UNSPSC 51181603: Liotrix

This classification denotes a thyroid hormone and thyroxine-triiodothyronine drug combination with the molecular formula C30H23I7N2O8, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier YW8HJ0N26X, more generally known as liotrix, chemically known as (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid;(2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3, 5-diiodophenyl]propanoic acid, but generally known as liotrix. As of Q4 2014, LIOTRIX remains the US FDA Preferred Term for this commodity.

Liotrix bears US NLM identifiers UMLS ID C0936106 and NCI Concept Code C87251. SMILES: C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(C(=O)O)N)I)I)O.C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)O)N.

UNSPSC 51181603 Liotrix is a Commodity code covering the procurement of liotrix, a synthetic thyroid hormone replacement medication used in treatment of hypothyroidism and thyroid cancer. State and local governments procure this drug primarily through Medicaid programs, corrections departments, and public health agencies that operate clinics and dispensaries. The code captures both branded and generic formulations across standard dosage strengths. Issuing bodies include state Medicaid agencies, county health departments, correctional healthcare providers, and public hospital systems that serve uninsured or underinsured populations.

The source provides no record of recent state and local contract opportunities solicited under this UNSPSC code.